C26H48O3Si2 — CID 134930493
(1S,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-4-methylidene-1-phenylhexan-1-ol (PubChem CID 134930493) has the molecular formula C26H48O3Si2 and a molecular weight of 464.84 g/mol. Its IUPAC name is (1S,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-4-methylidene-1-phenylhexan-1-ol.
| Compound Name | (1S,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-4-methylidene-1-phenylhexan-1-ol |
|---|---|
| PubChem CID | 134930493 |
| Molecular Formula | C26H48O3Si2 |
| Molecular Weight | 464.84 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | (1S,2R,3S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-4-methylidene-1-phenylhexan-1-ol |
| SMILES | C=C(CCO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C26H48O3Si2/c1-20(18-19-28-30(9,10)25(3,4)5)24(29-31(11,12)26(6,7)8)21(2)23(27)22-16-14-13-15-17-22/h13-17,21,23-24,27H,1,18-19H2,2-12H3/t21-,23+,24-/m1/s1 |
| InChIKey | KEUOLCRSKJCMAK-YFNKSVMNSA-N |
| XLogP | 7.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.84 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|