C18H30OSi — CID 101349147
tert-butyl-dimethyl-[(2S)-3-methylidene-5-phenylpentan-2-yl]oxysilane (PubChem CID 101349147) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-3-methylidene-5-phenylpentan-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S)-3-methylidene-5-phenylpentan-2-yl]oxysilane |
|---|---|
| PubChem CID | 101349147 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-3-methylidene-5-phenylpentan-2-yl]oxysilane |
| SMILES | C=C(CCc1ccccc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H30OSi/c1-15(13-14-17-11-9-8-10-12-17)16(2)19-20(6,7)18(3,4)5/h8-12,16H,1,13-14H2,2-7H3/t16-/m0/s1 |
| InChIKey | NGTDHDLATSENMR-INIZCTEOSA-N |
| XLogP | 5.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|