C18H26O2 — CID 10540298
(1S)-3-[(R)-cyclohexyl(methoxy)methyl]-1-phenylbut-3-en-1-ol (PubChem CID 10540298) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1S)-3-[(R)-cyclohexyl(methoxy)methyl]-1-phenylbut-3-en-1-ol.
| Compound Name | (1S)-3-[(R)-cyclohexyl(methoxy)methyl]-1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 10540298 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1S)-3-[(R)-cyclohexyl(methoxy)methyl]-1-phenylbut-3-en-1-ol |
| SMILES | C=C(C[C@H](O)c1ccccc1)[C@H](OC)C1CCCCC1 |
| InChI | InChI=1S/C18H26O2/c1-14(13-17(19)15-9-5-3-6-10-15)18(20-2)16-11-7-4-8-12-16/h3,5-6,9-10,16-19H,1,4,7-8,11-13H2,2H3/t17-,18-/m0/s1 |
| InChIKey | JTAQYQOVHXNDEA-ROUUACIJSA-N |
| XLogP | 4.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|