C18H26O2 — CID 10683740
(1S,4R)-1-cyclohexyl-3-methylidene-4-phenylpentane-1,5-diol (PubChem CID 10683740) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1S,4R)-1-cyclohexyl-3-methylidene-4-phenylpentane-1,5-diol.
| Compound Name | (1S,4R)-1-cyclohexyl-3-methylidene-4-phenylpentane-1,5-diol |
|---|---|
| PubChem CID | 10683740 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1S,4R)-1-cyclohexyl-3-methylidene-4-phenylpentane-1,5-diol |
| SMILES | C=C(C[C@H](O)C1CCCCC1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C18H26O2/c1-14(12-18(20)16-10-6-3-7-11-16)17(13-19)15-8-4-2-5-9-15/h2,4-5,8-9,16-20H,1,3,6-7,10-13H2/t17-,18+/m1/s1 |
| InChIKey | LVKMIFNFLQLQKT-MSOLQXFVSA-N |
| XLogP | 3.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|