C23H36O3Si — CID 11014594
2-[[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]prop-2-enyl benzoate (PubChem CID 11014594) has the molecular formula C23H36O3Si and a molecular weight of 388.62 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]prop-2-enyl benzoate.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]prop-2-enyl benzoate |
|---|---|
| PubChem CID | 11014594 |
| Molecular Formula | C23H36O3Si |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxy-cyclohexylmethyl]prop-2-enyl benzoate |
| SMILES | C=C(COC(=O)c1ccccc1)C(O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C23H36O3Si/c1-18(17-25-22(24)20-15-11-8-12-16-20)21(19-13-9-7-10-14-19)26-27(5,6)23(2,3)4/h8,11-12,15-16,19,21H,1,7,9-10,13-14,17H2,2-6H3 |
| InChIKey | MJXOUVVFSLZLHZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|