C20H27N3O3 — CID 91592333
cyclohexylmethyl 6-(4-aminophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 91592333) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is cyclohexylmethyl 6-(4-aminophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 6-(4-aminophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91592333 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | cyclohexylmethyl 6-(4-aminophenyl)-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=NC(=O)NC(c2ccc(N)cc2)C1C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C20H27N3O3/c1-2-16-17(19(24)26-12-13-6-4-3-5-7-13)18(23-20(25)22-16)14-8-10-15(21)11-9-14/h8-11,13,17-18H,2-7,12,21H2,1H3,(H,23,25) |
| InChIKey | FQKIDTUZQQPLHJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|