C23H31N3O5 — CID 91085844
cyclohexylmethyl 6-[3-(2-aminopropanoyloxy)phenyl]-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 91085844) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is cyclohexylmethyl 6-[3-(2-aminopropanoyloxy)phenyl]-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 6-[3-(2-aminopropanoyloxy)phenyl]-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91085844 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | cyclohexylmethyl 6-[3-(2-aminopropanoyloxy)phenyl]-4-ethyl-2-oxo-5,6-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=NC(=O)NC(c2cccc(OC(=O)C(C)N)c2)C1C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C23H31N3O5/c1-3-18-19(22(28)30-13-15-8-5-4-6-9-15)20(26-23(29)25-18)16-10-7-11-17(12-16)31-21(27)14(2)24/h7,10-12,14-15,19-20H,3-6,8-9,13,24H2,1-2H3,(H,26,29) |
| InChIKey | IQNKNPWXUOXSTD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|