C27H30N2O5 — CID 46194070
cyclohexylmethyl (4S)-4-(3-benzoyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 46194070) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is cyclohexylmethyl (4S)-4-(3-benzoyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl (4S)-4-(3-benzoyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 46194070 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | cyclohexylmethyl (4S)-4-(3-benzoyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=C(C(=O)OCC2CCCCC2)[C@H](c2cccc(OC(=O)c3ccccc3)c2)NC(=O)N1 |
| InChI | InChI=1S/C27H30N2O5/c1-2-22-23(26(31)33-17-18-10-5-3-6-11-18)24(29-27(32)28-22)20-14-9-15-21(16-20)34-25(30)19-12-7-4-8-13-19/h4,7-9,12-16,18,24H,2-3,5-6,10-11,17H2,1H3,(H2,28,29,32)/t24-/m0/s1 |
| InChIKey | XYMUPKVAWLGNDL-DEOSSOPVSA-N |
| XLogP | 5.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|