C25H38N4O3 — CID 68626449
cyclohexylmethyl 4-[4-(5-aminopentylamino)phenyl]-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 68626449) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is cyclohexylmethyl 4-[4-(5-aminopentylamino)phenyl]-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 4-[4-(5-aminopentylamino)phenyl]-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 68626449 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | cyclohexylmethyl 4-[4-(5-aminopentylamino)phenyl]-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=C(C(=O)OCC2CCCCC2)C(c2ccc(NCCCCCN)cc2)NC(=O)N1 |
| InChI | InChI=1S/C25H38N4O3/c1-2-21-22(24(30)32-17-18-9-5-3-6-10-18)23(29-25(31)28-21)19-11-13-20(14-12-19)27-16-8-4-7-15-26/h11-14,18,23,27H,2-10,15-17,26H2,1H3,(H2,28,29,31) |
| InChIKey | RJDOZYOKBNDITG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|