C25H34N2O6 — CID 68641623
cyclohexylmethyl 4-(3-butoxycarbonyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 68641623) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is cyclohexylmethyl 4-(3-butoxycarbonyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 4-(3-butoxycarbonyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 68641623 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | cyclohexylmethyl 4-(3-butoxycarbonyloxyphenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCOC(=O)Oc1cccc(C2NC(=O)NC(CC)=C2C(=O)OCC2CCCCC2)c1 |
| InChI | InChI=1S/C25H34N2O6/c1-3-5-14-31-25(30)33-19-13-9-12-18(15-19)22-21(20(4-2)26-24(29)27-22)23(28)32-16-17-10-7-6-8-11-17/h9,12-13,15,17,22H,3-8,10-11,14,16H2,1-2H3,(H2,26,27,29) |
| InChIKey | PLFBXSWEKUXYQN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|