C22H27ClN2O5 — CID 71588037
cyclohexylmethyl 4-(3-acetyloxy-4-chlorophenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 71588037) has the molecular formula C22H27ClN2O5 and a molecular weight of 434.92 g/mol. Its IUPAC name is cyclohexylmethyl 4-(3-acetyloxy-4-chlorophenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | cyclohexylmethyl 4-(3-acetyloxy-4-chlorophenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71588037 |
| Molecular Formula | C22H27ClN2O5 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | cyclohexylmethyl 4-(3-acetyloxy-4-chlorophenyl)-6-ethyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCC1=C(C(=O)OCC2CCCCC2)C(c2ccc(Cl)c(OC(C)=O)c2)NC(=O)N1 |
| InChI | InChI=1S/C22H27ClN2O5/c1-3-17-19(21(27)29-12-14-7-5-4-6-8-14)20(25-22(28)24-17)15-9-10-16(23)18(11-15)30-13(2)26/h9-11,14,20H,3-8,12H2,1-2H3,(H2,24,25,28) |
| InChIKey | HJAIOWMDFAKRJX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|