C26H22N2O4S — CID 23966172
benzyl 4-(3-benzoyloxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 23966172) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is benzyl 4-(3-benzoyloxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl 4-(3-benzoyloxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 23966172 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | benzyl 4-(3-benzoyloxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)C(c2cccc(OC(=O)c3ccccc3)c2)NC(=S)N1 |
| InChI | InChI=1S/C26H22N2O4S/c1-17-22(25(30)31-16-18-9-4-2-5-10-18)23(28-26(33)27-17)20-13-8-14-21(15-20)32-24(29)19-11-6-3-7-12-19/h2-15,23H,16H2,1H3,(H2,27,28,33) |
| InChIKey | VHDYHVSGFYAZTJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|