C21H22N2O4S — CID 7123801
benzyl (4R)-4-(3-ethoxy-4-hydroxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 7123801) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is benzyl (4R)-4-(3-ethoxy-4-hydroxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl (4R)-4-(3-ethoxy-4-hydroxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 7123801 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | benzyl (4R)-4-(3-ethoxy-4-hydroxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@H]2NC(=S)NC(C)=C2C(=O)OCc2ccccc2)ccc1O |
| InChI | InChI=1S/C21H22N2O4S/c1-3-26-17-11-15(9-10-16(17)24)19-18(13(2)22-21(28)23-19)20(25)27-12-14-7-5-4-6-8-14/h4-11,19,24H,3,12H2,1-2H3,(H2,22,23,28)/t19-/m1/s1 |
| InChIKey | ZVXNOXWNEUFVRB-LJQANCHMSA-N |
| XLogP | 3.33 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|