C26H32N2O4S — CID 35576089
benzyl (4S)-4-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 35576089) has the molecular formula C26H32N2O4S and a molecular weight of 468.62 g/mol. Its IUPAC name is benzyl (4S)-4-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | benzyl (4S)-4-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 35576089 |
| Molecular Formula | C26H32N2O4S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | benzyl (4S)-4-(4-hexoxy-3-methoxyphenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCCCOc1ccc([C@@H]2NC(=S)NC(C)=C2C(=O)OCc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H32N2O4S/c1-4-5-6-10-15-31-21-14-13-20(16-22(21)30-3)24-23(18(2)27-26(33)28-24)25(29)32-17-19-11-8-7-9-12-19/h7-9,11-14,16,24H,4-6,10,15,17H2,1-3H3,(H2,27,28,33)/t24-/m0/s1 |
| InChIKey | CKAWILQUBNAVHR-DEOSSOPVSA-N |
| XLogP | 5.19 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|