C17H28O2Si — CID 10517786
tert-butyl-dimethyl-[4-(2-methylprop-2-enoxymethyl)phenoxy]silane (PubChem CID 10517786) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-(2-methylprop-2-enoxymethyl)phenoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-(2-methylprop-2-enoxymethyl)phenoxy]silane |
|---|---|
| PubChem CID | 10517786 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | tert-butyl-dimethyl-[4-(2-methylprop-2-enoxymethyl)phenoxy]silane |
| SMILES | C=C(C)COCc1ccc(O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H28O2Si/c1-14(2)12-18-13-15-8-10-16(11-9-15)19-20(6,7)17(3,4)5/h8-11H,1,12-13H2,2-7H3 |
| InChIKey | FMHHHDPOBSDLTC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|