C24H22O5 — CID 10318227
4-phenyl-3-(3,4,5-trimethoxyphenyl)-3,4-dihydroisochromen-1-one (PubChem CID 10318227) has the molecular formula C24H22O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 4-phenyl-3-(3,4,5-trimethoxyphenyl)-3,4-dihydroisochromen-1-one.
| Compound Name | 4-phenyl-3-(3,4,5-trimethoxyphenyl)-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 10318227 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 4-phenyl-3-(3,4,5-trimethoxyphenyl)-3,4-dihydroisochromen-1-one |
| SMILES | COc1cc(C2OC(=O)c3ccccc3C2c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22O5/c1-26-19-13-16(14-20(27-2)23(19)28-3)22-21(15-9-5-4-6-10-15)17-11-7-8-12-18(17)24(25)29-22/h4-14,21-22H,1-3H3 |
| InChIKey | JWLWYLOWYDBKII-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |