C16H15NO5 — CID 139864325
1-(3,4,5-trimethoxyphenyl)-1H-furo[3,4-c]pyridin-3-one (PubChem CID 139864325) has the molecular formula C16H15NO5 and a molecular weight of 301.30 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-1H-furo[3,4-c]pyridin-3-one.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-1H-furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 139864325 |
| Molecular Formula | C16H15NO5 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-1H-furo[3,4-c]pyridin-3-one |
| SMILES | COc1cc(C2OC(=O)c3cnccc32)cc(OC)c1OC |
| InChI | InChI=1S/C16H15NO5/c1-19-12-6-9(7-13(20-2)15(12)21-3)14-10-4-5-17-8-11(10)16(18)22-14/h4-8,14H,1-3H3 |
| InChIKey | PVRODBILQVQZJE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |