C17H15BrO5 — CID 134937764
3-(3-bromo-2,5-dimethoxyphenyl)-4-methoxy-3H-2-benzofuran-1-one (PubChem CID 134937764) has the molecular formula C17H15BrO5 and a molecular weight of 379.21 g/mol. Its IUPAC name is 3-(3-bromo-2,5-dimethoxyphenyl)-4-methoxy-3H-2-benzofuran-1-one.
| Compound Name | 3-(3-bromo-2,5-dimethoxyphenyl)-4-methoxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134937764 |
| Molecular Formula | C17H15BrO5 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 3-(3-bromo-2,5-dimethoxyphenyl)-4-methoxy-3H-2-benzofuran-1-one |
| SMILES | COc1cc(Br)c(OC)c(C2OC(=O)c3cccc(OC)c32)c1 |
| InChI | InChI=1S/C17H15BrO5/c1-20-9-7-11(15(22-3)12(18)8-9)16-14-10(17(19)23-16)5-4-6-13(14)21-2/h4-8,16H,1-3H3 |
| InChIKey | DZTGBSXWYVNSJK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |