C24H21BrO4 — CID 102369605
3-(4-bromophenyl)-1-(2,4,6-trimethoxyphenyl)-1H-isochromene (PubChem CID 102369605) has the molecular formula C24H21BrO4 and a molecular weight of 453.33 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1-(2,4,6-trimethoxyphenyl)-1H-isochromene.
| Compound Name | 3-(4-bromophenyl)-1-(2,4,6-trimethoxyphenyl)-1H-isochromene |
|---|---|
| PubChem CID | 102369605 |
| Molecular Formula | C24H21BrO4 |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-(4-bromophenyl)-1-(2,4,6-trimethoxyphenyl)-1H-isochromene |
| SMILES | COc1cc(OC)c(C2OC(c3ccc(Br)cc3)=Cc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C24H21BrO4/c1-26-18-13-21(27-2)23(22(14-18)28-3)24-19-7-5-4-6-16(19)12-20(29-24)15-8-10-17(25)11-9-15/h4-14,24H,1-3H3 |
| InChIKey | MMKJFGAWBRNCES-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|