C21H20O4 — CID 132550834
3-[(1S)-7-methoxy-3-phenyl-1H-isochromen-1-yl]pentane-2,4-dione (PubChem CID 132550834) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 3-[(1S)-7-methoxy-3-phenyl-1H-isochromen-1-yl]pentane-2,4-dione.
| Compound Name | 3-[(1S)-7-methoxy-3-phenyl-1H-isochromen-1-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 132550834 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-[(1S)-7-methoxy-3-phenyl-1H-isochromen-1-yl]pentane-2,4-dione |
| SMILES | COc1ccc2c(c1)[C@H](C(C(C)=O)C(C)=O)OC(c1ccccc1)=C2 |
| InChI | InChI=1S/C21H20O4/c1-13(22)20(14(2)23)21-18-12-17(24-3)10-9-16(18)11-19(25-21)15-7-5-4-6-8-15/h4-12,20-21H,1-3H3/t21-/m1/s1 |
| InChIKey | SOEBQCZZCAQVJS-OAQYLSRUSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|