C20H17FO3 — CID 132550831
3-[(1S)-3-(3-fluorophenyl)-1H-isochromen-1-yl]pentane-2,4-dione (PubChem CID 132550831) has the molecular formula C20H17FO3 and a molecular weight of 324.35 g/mol. Its IUPAC name is 3-[(1S)-3-(3-fluorophenyl)-1H-isochromen-1-yl]pentane-2,4-dione.
| Compound Name | 3-[(1S)-3-(3-fluorophenyl)-1H-isochromen-1-yl]pentane-2,4-dione |
|---|---|
| PubChem CID | 132550831 |
| Molecular Formula | C20H17FO3 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-[(1S)-3-(3-fluorophenyl)-1H-isochromen-1-yl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H]1OC(c2cccc(F)c2)=Cc2ccccc21 |
| InChI | InChI=1S/C20H17FO3/c1-12(22)19(13(2)23)20-17-9-4-3-6-14(17)11-18(24-20)15-7-5-8-16(21)10-15/h3-11,19-20H,1-2H3/t20-/m1/s1 |
| InChIKey | UGDHEMGHINQIFY-HXUWFJFHSA-N |
| XLogP | 4.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|