C23H17FO3 — CID 1167366
(2S)-1-(4-fluorophenyl)-2-(9H-xanthen-9-yl)butane-1,3-dione (PubChem CID 1167366) has the molecular formula C23H17FO3 and a molecular weight of 360.38 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)-2-(9H-xanthen-9-yl)butane-1,3-dione.
| Compound Name | (2S)-1-(4-fluorophenyl)-2-(9H-xanthen-9-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 1167366 |
| Molecular Formula | C23H17FO3 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)-2-(9H-xanthen-9-yl)butane-1,3-dione |
| SMILES | CC(=O)[C@@H](C(=O)c1ccc(F)cc1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C23H17FO3/c1-14(25)21(23(26)15-10-12-16(24)13-11-15)22-17-6-2-4-8-19(17)27-20-9-5-3-7-18(20)22/h2-13,21-22H,1H3/t21-/m1/s1 |
| InChIKey | LHSFJGLRWCYDFF-OAQYLSRUSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|