C24H19ClO4 — CID 98154354
(2S)-2-[(9R)-2-chloro-9H-xanthen-9-yl]-1-(3-methoxyphenyl)butane-1,3-dione (PubChem CID 98154354) has the molecular formula C24H19ClO4 and a molecular weight of 406.87 g/mol. Its IUPAC name is (2S)-2-[(9R)-2-chloro-9H-xanthen-9-yl]-1-(3-methoxyphenyl)butane-1,3-dione.
| Compound Name | (2S)-2-[(9R)-2-chloro-9H-xanthen-9-yl]-1-(3-methoxyphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 98154354 |
| Molecular Formula | C24H19ClO4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | (2S)-2-[(9R)-2-chloro-9H-xanthen-9-yl]-1-(3-methoxyphenyl)butane-1,3-dione |
| SMILES | COc1cccc(C(=O)[C@H](C(C)=O)[C@@H]2c3ccccc3Oc3ccc(Cl)cc32)c1 |
| InChI | InChI=1S/C24H19ClO4/c1-14(26)22(24(27)15-6-5-7-17(12-15)28-2)23-18-8-3-4-9-20(18)29-21-11-10-16(25)13-19(21)23/h3-13,22-23H,1-2H3/t22-,23-/m1/s1 |
| InChIKey | MGKOJWCFINKESS-DHIUTWEWSA-N |
| XLogP | 5.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|