C18H20O7 — CID 118723066
methyl (4S)-6-methoxy-4-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methyl-4H-chromene-3-carboxylate (PubChem CID 118723066) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is methyl (4S)-6-methoxy-4-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methyl-4H-chromene-3-carboxylate.
| Compound Name | methyl (4S)-6-methoxy-4-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methyl-4H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 118723066 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | methyl (4S)-6-methoxy-4-[(2R)-1-methoxy-1,3-dioxobutan-2-yl]-2-methyl-4H-chromene-3-carboxylate |
| SMILES | COC(=O)C1=C(C)Oc2ccc(OC)cc2[C@@H]1[C@H](C(C)=O)C(=O)OC |
| InChI | InChI=1S/C18H20O7/c1-9(19)14(17(20)23-4)16-12-8-11(22-3)6-7-13(12)25-10(2)15(16)18(21)24-5/h6-8,14,16H,1-5H3/t14-,16+/m0/s1 |
| InChIKey | HOXPOZMALZBQEB-GOEBONIOSA-N |
| XLogP | 2.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|