C31H28O4 — CID 91286921
9H-fluoren-9-ylmethyl acetate;2-methoxy-9-methyl-9H-xanthene (PubChem CID 91286921) has the molecular formula C31H28O4 and a molecular weight of 464.56 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl acetate;2-methoxy-9-methyl-9H-xanthene.
| Compound Name | 9H-fluoren-9-ylmethyl acetate;2-methoxy-9-methyl-9H-xanthene |
|---|---|
| PubChem CID | 91286921 |
| Molecular Formula | C31H28O4 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 9H-fluoren-9-ylmethyl acetate;2-methoxy-9-methyl-9H-xanthene |
| SMILES | CC(=O)OCC1c2ccccc2-c2ccccc21.COc1ccc2c(c1)C(C)c1ccccc1O2 |
| InChI | InChI=1S/C16H14O2.C15H14O2/c1-11(17)18-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16;1-10-12-5-3-4-6-14(12)17-15-8-7-11(16-2)9-13(10)15/h2-9,16H,10H2,1H3;3-10H,1-2H3 |
| InChIKey | WCVZFYOYCTXRBI-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |