C10H9NO4 — CID 84820117
methyl 5-methoxy-1,2-benzoxazole-3-carboxylate (PubChem CID 84820117) has the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. Its IUPAC name is methyl 5-methoxy-1,2-benzoxazole-3-carboxylate.
| Compound Name | methyl 5-methoxy-1,2-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 84820117 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | methyl 5-methoxy-1,2-benzoxazole-3-carboxylate |
| SMILES | COC(=O)c1noc2ccc(OC)cc12 |
| InChI | InChI=1S/C10H9NO4/c1-13-6-3-4-8-7(5-6)9(11-15-8)10(12)14-2/h3-5H,1-2H3 |
| InChIKey | UXTZSMRXNWXVMO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |