C17H13NO5 — CID 67890566
methyl 3-(6-methoxy-4-oxo-1,3-benzoxazin-2-yl)benzoate (PubChem CID 67890566) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is methyl 3-(6-methoxy-4-oxo-1,3-benzoxazin-2-yl)benzoate.
| Compound Name | methyl 3-(6-methoxy-4-oxo-1,3-benzoxazin-2-yl)benzoate |
|---|---|
| PubChem CID | 67890566 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 3-(6-methoxy-4-oxo-1,3-benzoxazin-2-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2nc(=O)c3cc(OC)ccc3o2)c1 |
| InChI | InChI=1S/C17H13NO5/c1-21-12-6-7-14-13(9-12)15(19)18-16(23-14)10-4-3-5-11(8-10)17(20)22-2/h3-9H,1-2H3 |
| InChIKey | OTGOUHNZQIQDTG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |