C18H15NO4 — CID 91681366
prop-2-enyl 2-(3-methoxyphenyl)-1,3-benzoxazole-5-carboxylate (PubChem CID 91681366) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is prop-2-enyl 2-(3-methoxyphenyl)-1,3-benzoxazole-5-carboxylate.
| Compound Name | prop-2-enyl 2-(3-methoxyphenyl)-1,3-benzoxazole-5-carboxylate |
|---|---|
| PubChem CID | 91681366 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | prop-2-enyl 2-(3-methoxyphenyl)-1,3-benzoxazole-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2oc(-c3cccc(OC)c3)nc2c1 |
| InChI | InChI=1S/C18H15NO4/c1-3-9-22-18(20)13-7-8-16-15(11-13)19-17(23-16)12-5-4-6-14(10-12)21-2/h3-8,10-11H,1,9H2,2H3 |
| InChIKey | BVJGOULYKCQUKA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|