C25H24N2O4 — CID 17092655
4-butan-2-yloxy-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 17092655) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 4-butan-2-yloxy-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 4-butan-2-yloxy-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 17092655 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-butan-2-yloxy-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CCC(C)Oc1ccc(C(=O)Nc2ccc3oc(-c4cccc(OC)c4)nc3c2)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-4-16(2)30-20-11-8-17(9-12-20)24(28)26-19-10-13-23-22(15-19)27-25(31-23)18-6-5-7-21(14-18)29-3/h5-16H,4H2,1-3H3,(H,26,28) |
| InChIKey | XWDQKGYSVBGXJW-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |