C24H19ClF2N2O3 — CID 41187844
4-[(2S)-butan-2-yl]oxy-N-[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]benzamide (PubChem CID 41187844) has the molecular formula C24H19ClF2N2O3 and a molecular weight of 456.88 g/mol. Its IUPAC name is 4-[(2S)-butan-2-yl]oxy-N-[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]benzamide.
| Compound Name | 4-[(2S)-butan-2-yl]oxy-N-[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]benzamide |
|---|---|
| PubChem CID | 41187844 |
| Molecular Formula | C24H19ClF2N2O3 |
| Molecular Weight | 456.88 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 4-[(2S)-butan-2-yl]oxy-N-[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]benzamide |
| SMILES | CC[C@H](C)Oc1ccc(C(=O)Nc2ccc3oc(-c4cc(F)c(F)cc4Cl)nc3c2)cc1 |
| InChI | InChI=1S/C24H19ClF2N2O3/c1-3-13(2)31-16-7-4-14(5-8-16)23(30)28-15-6-9-22-21(10-15)29-24(32-22)17-11-19(26)20(27)12-18(17)25/h4-13H,3H2,1-2H3,(H,28,30)/t13-/m0/s1 |
| InChIKey | NZWPRHVHNQSFGE-ZDUSSCGKSA-N |
| XLogP | 6.86 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|