C15H8F3NO4 — CID 59828547
2-[3-(trifluoromethoxy)phenyl]-1,3-benzoxazole-5-carboxylic acid (PubChem CID 59828547) has the molecular formula C15H8F3NO4 and a molecular weight of 323.23 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]-1,3-benzoxazole-5-carboxylic acid.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]-1,3-benzoxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59828547 |
| Molecular Formula | C15H8F3NO4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]-1,3-benzoxazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2oc(-c3cccc(OC(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C15H8F3NO4/c16-15(17,18)23-10-3-1-2-8(6-10)13-19-11-7-9(14(20)21)4-5-12(11)22-13/h1-7H,(H,20,21) |
| InChIKey | WAQRCUXVOVEMCU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |