C9H7Br2NO2 — CID 119090324
3-(dibromomethyl)-5-methoxy-1,2-benzoxazole (PubChem CID 119090324) has the molecular formula C9H7Br2NO2 and a molecular weight of 320.97 g/mol. Its IUPAC name is 3-(dibromomethyl)-5-methoxy-1,2-benzoxazole.
| Compound Name | 3-(dibromomethyl)-5-methoxy-1,2-benzoxazole |
|---|---|
| PubChem CID | 119090324 |
| Molecular Formula | C9H7Br2NO2 |
| Molecular Weight | 320.97 g/mol |
| Exact Mass | 318.88 |
| IUPAC Name | 3-(dibromomethyl)-5-methoxy-1,2-benzoxazole |
| SMILES | COc1ccc2onc(C(Br)Br)c2c1 |
| InChI | InChI=1S/C9H7Br2NO2/c1-13-5-2-3-7-6(4-5)8(9(10)11)12-14-7/h2-4,9H,1H3 |
| InChIKey | KSVBEXDNTYMPQU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|