methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate

C10H6F3NO3 — CID 91756191

IUPACmethyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate
SMILESCOC(=O)c1ccc2onc(C(F)(F)F)c2c1
InChIInChI=1S/C10H6F3NO3/c1-16-9(15)5-2-3-7-6(4-5)8(14-17-7)10(11,12)13/h2-4H,1H3
InChIKeyRFTZZSGGSZHFKE-UHFFFAOYSA-N
MW245.16 g/mol
LogP2.63
Rot. Bonds1

About methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate

methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate (PubChem CID 91756191) has the molecular formula C10H6F3NO3 and a molecular weight of 245.16 g/mol. Its IUPAC name is methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate
PubChem CID91756191
Molecular FormulaC10H6F3NO3
Molecular Weight245.16 g/mol
Exact Mass245.03
IUPAC Namemethyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate
SMILESCOC(=O)c1ccc2onc(C(F)(F)F)c2c1
InChIInChI=1S/C10H6F3NO3/c1-16-9(15)5-2-3-7-6(4-5)8(14-17-7)10(11,12)13/h2-4H,1H3
InChIKeyRFTZZSGGSZHFKE-UHFFFAOYSA-N
XLogP2.63
TPSA52.33 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.16
LogP ≤ 52.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
The IUPAC name of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate (CID 91756191) is methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate.
What is the SMILES notation for methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
The canonical SMILES for methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate is COC(=O)c1ccc2onc(C(F)(F)F)c2c1.
What is the InChIKey of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
The InChIKey is RFTZZSGGSZHFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NO3/c1-16-9(15)5-2-3-7-6(4-5)8(14-17-7)10(11,12)13/h2-4H,1H3.
What are the key properties of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate has a molecular weight of 245.16 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate is sourced from PubChem (CID 91756191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).