About methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate
methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate (PubChem CID 91756191) has the molecular formula C10H6F3NO3
and a molecular weight of 245.16 g/mol. Its IUPAC name is methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate.
Analyze methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
The IUPAC name of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate (CID 91756191) is methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate.
What is the SMILES notation for methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
The canonical SMILES for methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate is COC(=O)c1ccc2onc(C(F)(F)F)c2c1.
What is the InChIKey of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
The InChIKey is RFTZZSGGSZHFKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F3NO3/c1-16-9(15)5-2-3-7-6(4-5)8(14-17-7)10(11,12)13/h2-4H,1H3.
What are the key properties of methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate?
methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate has a molecular weight of 245.16 g/mol, XLogP of 2.63, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(trifluoromethyl)-1,2-benzoxazole-5-carboxylate is sourced from PubChem (CID 91756191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).