C16H14O5 — CID 23283018
2,6-dimethoxy-9H-xanthene-9-carboxylic acid (PubChem CID 23283018) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 2,6-dimethoxy-9H-xanthene-9-carboxylic acid.
| Compound Name | 2,6-dimethoxy-9H-xanthene-9-carboxylic acid |
|---|---|
| PubChem CID | 23283018 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2,6-dimethoxy-9H-xanthene-9-carboxylic acid |
| SMILES | COc1ccc2c(c1)Oc1ccc(OC)cc1C2C(=O)O |
| InChI | InChI=1S/C16H14O5/c1-19-9-4-6-13-12(7-9)15(16(17)18)11-5-3-10(20-2)8-14(11)21-13/h3-8,15H,1-2H3,(H,17,18) |
| InChIKey | QKOAZDXIXHHYCC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |