C24H20O3S — CID 92651926
(2S)-1-(3-methoxyphenyl)-2-(9H-thioxanthen-9-yl)butane-1,3-dione (PubChem CID 92651926) has the molecular formula C24H20O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is (2S)-1-(3-methoxyphenyl)-2-(9H-thioxanthen-9-yl)butane-1,3-dione.
| Compound Name | (2S)-1-(3-methoxyphenyl)-2-(9H-thioxanthen-9-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 92651926 |
| Molecular Formula | C24H20O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (2S)-1-(3-methoxyphenyl)-2-(9H-thioxanthen-9-yl)butane-1,3-dione |
| SMILES | COc1cccc(C(=O)[C@H](C(C)=O)C2c3ccccc3Sc3ccccc32)c1 |
| InChI | InChI=1S/C24H20O3S/c1-15(25)22(24(26)16-8-7-9-17(14-16)27-2)23-18-10-3-5-12-20(18)28-21-13-6-4-11-19(21)23/h3-14,22-23H,1-2H3/t22-/m1/s1 |
| InChIKey | QPQFRZCRHSFHHE-JOCHJYFZSA-N |
| XLogP | 5.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|