C25H21F3O4 — CID 102369607
3-[2-(trifluoromethyl)phenyl]-1-(2,4,6-trimethoxyphenyl)-1H-isochromene (PubChem CID 102369607) has the molecular formula C25H21F3O4 and a molecular weight of 442.43 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)phenyl]-1-(2,4,6-trimethoxyphenyl)-1H-isochromene.
| Compound Name | 3-[2-(trifluoromethyl)phenyl]-1-(2,4,6-trimethoxyphenyl)-1H-isochromene |
|---|---|
| PubChem CID | 102369607 |
| Molecular Formula | C25H21F3O4 |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 3-[2-(trifluoromethyl)phenyl]-1-(2,4,6-trimethoxyphenyl)-1H-isochromene |
| SMILES | COc1cc(OC)c(C2OC(c3ccccc3C(F)(F)F)=Cc3ccccc32)c(OC)c1 |
| InChI | InChI=1S/C25H21F3O4/c1-29-16-13-21(30-2)23(22(14-16)31-3)24-17-9-5-4-8-15(17)12-20(32-24)18-10-6-7-11-19(18)25(26,27)28/h4-14,24H,1-3H3 |
| InChIKey | VKAVAJAUHBDHGP-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|