C20H19Cl3O5 — CID 2865367
3-(2,4-dimethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene (PubChem CID 2865367) has the molecular formula C20H19Cl3O5 and a molecular weight of 445.73 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene.
| Compound Name | 3-(2,4-dimethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene |
|---|---|
| PubChem CID | 2865367 |
| Molecular Formula | C20H19Cl3O5 |
| Molecular Weight | 445.73 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-6,7-dimethoxy-1-(trichloromethyl)-1H-isochromene |
| SMILES | COc1ccc(C2=Cc3cc(OC)c(OC)cc3C(C(Cl)(Cl)Cl)O2)c(OC)c1 |
| InChI | InChI=1S/C20H19Cl3O5/c1-24-12-5-6-13(15(9-12)25-2)16-7-11-8-17(26-3)18(27-4)10-14(11)19(28-16)20(21,22)23/h5-10,19H,1-4H3 |
| InChIKey | IFKZVLAQFBAJFZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|