C20H13F6NO — CID 134618215
4-methoxy-2,6-bis[2-(trifluoromethyl)phenyl]pyridine (PubChem CID 134618215) has the molecular formula C20H13F6NO and a molecular weight of 397.32 g/mol. Its IUPAC name is 4-methoxy-2,6-bis[2-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 4-methoxy-2,6-bis[2-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 134618215 |
| Molecular Formula | C20H13F6NO |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 4-methoxy-2,6-bis[2-(trifluoromethyl)phenyl]pyridine |
| SMILES | COc1cc(-c2ccccc2C(F)(F)F)nc(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C20H13F6NO/c1-28-12-10-17(13-6-2-4-8-15(13)19(21,22)23)27-18(11-12)14-7-3-5-9-16(14)20(24,25)26/h2-11H,1H3 |
| InChIKey | JDTSMBJXZXAFCH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |