C24H20F3O4S+ — CID 164686364
1,3,6,8-tetramethoxy-9-[2-(trifluoromethyl)phenyl]thioxanthen-10-ium (PubChem CID 164686364) has the molecular formula C24H20F3O4S+ and a molecular weight of 461.48 g/mol. Its IUPAC name is 1,3,6,8-tetramethoxy-9-[2-(trifluoromethyl)phenyl]thioxanthen-10-ium.
| Compound Name | 1,3,6,8-tetramethoxy-9-[2-(trifluoromethyl)phenyl]thioxanthen-10-ium |
|---|---|
| PubChem CID | 164686364 |
| Molecular Formula | C24H20F3O4S+ |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 1,3,6,8-tetramethoxy-9-[2-(trifluoromethyl)phenyl]thioxanthen-10-ium |
| SMILES | COc1cc(OC)c2c(-c3ccccc3C(F)(F)F)c3c(OC)cc(OC)cc3[s+]c2c1 |
| InChI | InChI=1S/C24H20F3O4S/c1-28-13-9-17(30-3)22-19(11-13)32-20-12-14(29-2)10-18(31-4)23(20)21(22)15-7-5-6-8-16(15)24(25,26)27/h5-12H,1-4H3/q+1 |
| InChIKey | PGMPPTGFBFTZIC-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|