C17H17NO5 — CID 10686792
2-(3,4,5-trimethoxyphenyl)-4H-1,4-benzoxazin-3-one (PubChem CID 10686792) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 10686792 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cc(C2Oc3ccccc3NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C17H17NO5/c1-20-13-8-10(9-14(21-2)16(13)22-3)15-17(19)18-11-6-4-5-7-12(11)23-15/h4-9,15H,1-3H3,(H,18,19) |
| InChIKey | KIXLAGFXDKAHTC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |