C17H18N2O6S — CID 110404413
2,4-dimethoxy-N-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzenesulfonamide (PubChem CID 110404413) has the molecular formula C17H18N2O6S and a molecular weight of 378.41 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110404413 |
| Molecular Formula | C17H18N2O6S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2,4-dimethoxy-N-[(3-oxo-4H-1,4-benzoxazin-2-yl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC2Oc3ccccc3NC2=O)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O6S/c1-23-11-7-8-16(14(9-11)24-2)26(21,22)18-10-15-17(20)19-12-5-3-4-6-13(12)25-15/h3-9,15,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | FYEMSTVJUMDABO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |