C16H19NO5S — CID 6468216
2,4-dimethoxy-N-[(2-methoxyphenyl)methyl]benzenesulfonamide (PubChem CID 6468216) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(2-methoxyphenyl)methyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[(2-methoxyphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6468216 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2,4-dimethoxy-N-[(2-methoxyphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccccc2OC)c(OC)c1 |
| InChI | InChI=1S/C16H19NO5S/c1-20-13-8-9-16(15(10-13)22-3)23(18,19)17-11-12-6-4-5-7-14(12)21-2/h4-10,17H,11H2,1-3H3 |
| InChIKey | KSAPSPBZSSAVDV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |