C15H12BrNO2 — CID 59104534
(2S)-2-(5-bromo-2-methylphenyl)-4H-1,4-benzoxazin-3-one (PubChem CID 59104534) has the molecular formula C15H12BrNO2 and a molecular weight of 318.17 g/mol. Its IUPAC name is (2S)-2-(5-bromo-2-methylphenyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | (2S)-2-(5-bromo-2-methylphenyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 59104534 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | (2S)-2-(5-bromo-2-methylphenyl)-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(Br)cc1[C@@H]1Oc2ccccc2NC1=O |
| InChI | InChI=1S/C15H12BrNO2/c1-9-6-7-10(16)8-11(9)14-15(18)17-12-4-2-3-5-13(12)19-14/h2-8,14H,1H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | VYSJZTCLCZRQHH-AWEZNQCLSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |