C12H13NO3 — CID 15715766
5,6,8-trimethoxyisoquinoline (PubChem CID 15715766) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5,6,8-trimethoxyisoquinoline.
| Compound Name | 5,6,8-trimethoxyisoquinoline |
|---|---|
| PubChem CID | 15715766 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 5,6,8-trimethoxyisoquinoline |
| SMILES | COc1cc(OC)c2cnccc2c1OC |
| InChI | InChI=1S/C12H13NO3/c1-14-10-6-11(15-2)12(16-3)8-4-5-13-7-9(8)10/h4-7H,1-3H3 |
| InChIKey | SWSFMQVEIQYSAD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |