About 5,6,8-trimethoxyisoquinoline
5,6,8-trimethoxyisoquinoline (PubChem CID 15715766) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 5,6,8-trimethoxyisoquinoline.
Molecular Properties
| Compound Name | 5,6,8-trimethoxyisoquinoline |
| PubChem CID | 15715766 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 5,6,8-trimethoxyisoquinoline |
| SMILES | COc1cc(OC)c2cnccc2c1OC |
| InChI | InChI=1S/C12H13NO3/c1-14-10-6-11(15-2)12(16-3)8-4-5-13-7-9(8)10/h4-7H,1-3H3 |
| InChIKey | SWSFMQVEIQYSAD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6,8-trimethoxyisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,8-trimethoxyisoquinoline?
The IUPAC name of 5,6,8-trimethoxyisoquinoline (CID 15715766) is 5,6,8-trimethoxyisoquinoline.
What is the SMILES notation for 5,6,8-trimethoxyisoquinoline?
The canonical SMILES for 5,6,8-trimethoxyisoquinoline is COc1cc(OC)c2cnccc2c1OC.
What is the InChIKey of 5,6,8-trimethoxyisoquinoline?
The InChIKey is SWSFMQVEIQYSAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-14-10-6-11(15-2)12(16-3)8-4-5-13-7-9(8)10/h4-7H,1-3H3.
What are the key properties of 5,6,8-trimethoxyisoquinoline?
5,6,8-trimethoxyisoquinoline has a molecular weight of 219.24 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,8-trimethoxyisoquinoline is sourced from PubChem (CID 15715766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).