C17H16O4 — CID 42629980
(3S)-3-[(3,4-dimethoxyphenyl)methyl]-3H-2-benzofuran-1-one (PubChem CID 42629980) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is (3S)-3-[(3,4-dimethoxyphenyl)methyl]-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-[(3,4-dimethoxyphenyl)methyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 42629980 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (3S)-3-[(3,4-dimethoxyphenyl)methyl]-3H-2-benzofuran-1-one |
| SMILES | COc1ccc(C[C@@H]2OC(=O)c3ccccc32)cc1OC |
| InChI | InChI=1S/C17H16O4/c1-19-14-8-7-11(10-16(14)20-2)9-15-12-5-3-4-6-13(12)17(18)21-15/h3-8,10,15H,9H2,1-2H3/t15-/m0/s1 |
| InChIKey | MKYGGTKVINYUIC-HNNXBMFYSA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |