C12H16O4 — CID 24727770
2-[(3,4-dimethoxyphenyl)methyl]-1,3-dioxolane (PubChem CID 24727770) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1,3-dioxolane.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 24727770 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1,3-dioxolane |
| SMILES | COc1ccc(CC2OCCO2)cc1OC |
| InChI | InChI=1S/C12H16O4/c1-13-10-4-3-9(7-11(10)14-2)8-12-15-5-6-16-12/h3-4,7,12H,5-6,8H2,1-2H3 |
| InChIKey | OTMVVWDRCLJXKA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |