C23H32ClNO4 — CID 90679135
2,5-bis[(3,4-dimethoxyphenyl)methyl]cyclopentan-1-amine;hydrochloride (PubChem CID 90679135) has the molecular formula C23H32ClNO4 and a molecular weight of 421.97 g/mol. Its IUPAC name is 2,5-bis[(3,4-dimethoxyphenyl)methyl]cyclopentan-1-amine;hydrochloride.
| Compound Name | 2,5-bis[(3,4-dimethoxyphenyl)methyl]cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 90679135 |
| Molecular Formula | C23H32ClNO4 |
| Molecular Weight | 421.97 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2,5-bis[(3,4-dimethoxyphenyl)methyl]cyclopentan-1-amine;hydrochloride |
| SMILES | COc1ccc(CC2CCC(Cc3ccc(OC)c(OC)c3)C2N)cc1OC.Cl |
| InChI | InChI=1S/C23H31NO4.ClH/c1-25-19-9-5-15(13-21(19)27-3)11-17-7-8-18(23(17)24)12-16-6-10-20(26-2)22(14-16)28-4;/h5-6,9-10,13-14,17-18,23H,7-8,11-12,24H2,1-4H3;1H |
| InChIKey | ZBGMJUPSDGYCKS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.97 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |