C13H16O3 — CID 135056530
(2S)-2-[(3,4-dimethoxyphenyl)methyl]-2,5-dihydrofuran (PubChem CID 135056530) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S)-2-[(3,4-dimethoxyphenyl)methyl]-2,5-dihydrofuran.
| Compound Name | (2S)-2-[(3,4-dimethoxyphenyl)methyl]-2,5-dihydrofuran |
|---|---|
| PubChem CID | 135056530 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2S)-2-[(3,4-dimethoxyphenyl)methyl]-2,5-dihydrofuran |
| SMILES | COc1ccc(C[C@H]2C=CCO2)cc1OC |
| InChI | InChI=1S/C13H16O3/c1-14-12-6-5-10(9-13(12)15-2)8-11-4-3-7-16-11/h3-6,9,11H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | PCUCTKWDTXECSQ-LLVKDONJSA-N |
| XLogP | 2.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|