C14H21NO2 — CID 23009517
4-[(3,4-dimethoxyphenyl)methyl]-2-methylpyrrolidine (PubChem CID 23009517) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyphenyl)methyl]-2-methylpyrrolidine.
| Compound Name | 4-[(3,4-dimethoxyphenyl)methyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 23009517 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-[(3,4-dimethoxyphenyl)methyl]-2-methylpyrrolidine |
| SMILES | COc1ccc(CC2CNC(C)C2)cc1OC |
| InChI | InChI=1S/C14H21NO2/c1-10-6-12(9-15-10)7-11-4-5-13(16-2)14(8-11)17-3/h4-5,8,10,12,15H,6-7,9H2,1-3H3 |
| InChIKey | YSOYFIVEYLPHKB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |