C25H23Cl2NO7 — CID 122683145
[(R)-(3,5-dichloro-4-pyridinyl)oxy-(3,4-dimethoxyphenyl)methyl] 4-(1,3-dioxolan-2-ylmethyl)benzoate (PubChem CID 122683145) has the molecular formula C25H23Cl2NO7 and a molecular weight of 520.37 g/mol. Its IUPAC name is [(R)-(3,5-dichloro-4-pyridinyl)oxy-(3,4-dimethoxyphenyl)methyl] 4-(1,3-dioxolan-2-ylmethyl)benzoate.
| Compound Name | [(R)-(3,5-dichloro-4-pyridinyl)oxy-(3,4-dimethoxyphenyl)methyl] 4-(1,3-dioxolan-2-ylmethyl)benzoate |
|---|---|
| PubChem CID | 122683145 |
| Molecular Formula | C25H23Cl2NO7 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | [(R)-(3,5-dichloro-4-pyridinyl)oxy-(3,4-dimethoxyphenyl)methyl] 4-(1,3-dioxolan-2-ylmethyl)benzoate |
| SMILES | COc1ccc([C@@H](OC(=O)c2ccc(CC3OCCO3)cc2)Oc2c(Cl)cncc2Cl)cc1OC |
| InChI | InChI=1S/C25H23Cl2NO7/c1-30-20-8-7-17(12-21(20)31-2)25(34-23-18(26)13-28-14-19(23)27)35-24(29)16-5-3-15(4-6-16)11-22-32-9-10-33-22/h3-8,12-14,22,25H,9-11H2,1-2H3/t25-/m1/s1 |
| InChIKey | QHGFOCIVMSCRMU-RUZDIDTESA-N |
| XLogP | 5.26 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|